C21H21F3N4O3S — CID 154924665
3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-5-(4,5,6,7-tetrahydro-2-benzothiophen-1-yl)-1,2,4-oxadiazole;2,2,2-trifluoroacetic acid (PubChem CID 154924665) has the molecular formula C21H21F3N4O3S and a molecular weight of 466.49 g/mol. Its IUPAC name is 3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-5-(4,5,6,7-tetrahydro-2-benzothiophen-1-yl)-1,2,4-oxadiazole;2,2,2-trifluoroacetic acid.
| Compound Name | 3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-5-(4,5,6,7-tetrahydro-2-benzothiophen-1-yl)-1,2,4-oxadiazole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 154924665 |
| Molecular Formula | C21H21F3N4O3S |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | 3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-5-(4,5,6,7-tetrahydro-2-benzothiophen-1-yl)-1,2,4-oxadiazole;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ncc2c(c1-c1noc(-c3scc4c3CCCC4)n1)CCNC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H20N4OS.C2HF3O2/c1-11-16(14-6-7-20-8-13(14)9-21-11)18-22-19(24-23-18)17-15-5-3-2-4-12(15)10-25-17;3-2(4,5)1(6)7/h9-10,20H,2-8H2,1H3;(H,6,7) |
| InChIKey | PDCGLURPLXWJLE-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 101.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |