C19H17F3N4O4S — CID 154924711
1-[4-[3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-1,2,4-oxadiazol-5-yl]thiophen-2-yl]ethanone;2,2,2-trifluoroacetic acid (PubChem CID 154924711) has the molecular formula C19H17F3N4O4S and a molecular weight of 454.43 g/mol. Its IUPAC name is 1-[4-[3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-1,2,4-oxadiazol-5-yl]thiophen-2-yl]ethanone;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[4-[3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-1,2,4-oxadiazol-5-yl]thiophen-2-yl]ethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 154924711 |
| Molecular Formula | C19H17F3N4O4S |
| Molecular Weight | 454.43 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | 1-[4-[3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-1,2,4-oxadiazol-5-yl]thiophen-2-yl]ethanone;2,2,2-trifluoroacetic acid |
| SMILES | CC(=O)c1cc(-c2nc(-c3c(C)ncc4c3CCNC4)no2)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H16N4O2S.C2HF3O2/c1-9-15(13-3-4-18-6-12(13)7-19-9)16-20-17(23-21-16)11-5-14(10(2)22)24-8-11;3-2(4,5)1(6)7/h5,7-8,18H,3-4,6H2,1-2H3;(H,6,7) |
| InChIKey | QWRGCCKEPJJQEY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 118.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |