C20H23F3N4O2 — CID 154924761
2-[(3-ethyl-4-methyl-1H-pyrazol-5-yl)methyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole;2,2,2-trifluoroacetic acid (PubChem CID 154924761) has the molecular formula C20H23F3N4O2 and a molecular weight of 408.42 g/mol. Its IUPAC name is 2-[(3-ethyl-4-methyl-1H-pyrazol-5-yl)methyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[(3-ethyl-4-methyl-1H-pyrazol-5-yl)methyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 154924761 |
| Molecular Formula | C20H23F3N4O2 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 2-[(3-ethyl-4-methyl-1H-pyrazol-5-yl)methyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole;2,2,2-trifluoroacetic acid |
| SMILES | CCc1n[nH]c(CN2CCc3[nH]c4ccccc4c3C2)c1C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H22N4.C2HF3O2/c1-3-15-12(2)18(21-20-15)11-22-9-8-17-14(10-22)13-6-4-5-7-16(13)19-17;3-2(4,5)1(6)7/h4-7,19H,3,8-11H2,1-2H3,(H,20,21);(H,6,7) |
| InChIKey | SIFISPQFJVJZRN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 85.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|