C20H19F3N4O4S — CID 154924779
1-[4-[[3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-1,2,4-oxadiazol-5-yl]methyl]thiophen-2-yl]ethanone;2,2,2-trifluoroacetic acid (PubChem CID 154924779) has the molecular formula C20H19F3N4O4S and a molecular weight of 468.46 g/mol. Its IUPAC name is 1-[4-[[3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-1,2,4-oxadiazol-5-yl]methyl]thiophen-2-yl]ethanone;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[4-[[3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-1,2,4-oxadiazol-5-yl]methyl]thiophen-2-yl]ethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 154924779 |
| Molecular Formula | C20H19F3N4O4S |
| Molecular Weight | 468.46 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | 1-[4-[[3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-1,2,4-oxadiazol-5-yl]methyl]thiophen-2-yl]ethanone;2,2,2-trifluoroacetic acid |
| SMILES | CC(=O)c1cc(Cc2nc(-c3c(C)ncc4c3CCNC4)no2)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H18N4O2S.C2HF3O2/c1-10-17(14-3-4-19-7-13(14)8-20-10)18-21-16(24-22-18)6-12-5-15(11(2)23)25-9-12;3-2(4,5)1(6)7/h5,8-9,19H,3-4,6-7H2,1-2H3;(H,6,7) |
| InChIKey | AFDCBDWMHILIKP-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 118.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.46 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |