About N-[(1,5-dimethylindazol-3-yl)methyl]-3-azaspiro[5.5]undecan-9-amine;dihydrochloride
N-[(1,5-dimethylindazol-3-yl)methyl]-3-azaspiro[5.5]undecan-9-amine;dihydrochloride (PubChem CID 154924781) has the molecular formula C20H32Cl2N4
and a molecular weight of 399.41 g/mol. Its IUPAC name is N-[(1,5-dimethylindazol-3-yl)methyl]-3-azaspiro[5.5]undecan-9-amine;dihydrochloride.
Molecular Properties
| Compound Name | N-[(1,5-dimethylindazol-3-yl)methyl]-3-azaspiro[5.5]undecan-9-amine;dihydrochloride |
| PubChem CID | 154924781 |
| Molecular Formula | C20H32Cl2N4 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | N-[(1,5-dimethylindazol-3-yl)methyl]-3-azaspiro[5.5]undecan-9-amine;dihydrochloride |
| SMILES | Cc1ccc2c(c1)c(CNC1CCC3(CCNCC3)CC1)nn2C.Cl.Cl |
| InChI | InChI=1S/C20H30N4.2ClH/c1-15-3-4-19-17(13-15)18(23-24(19)2)14-22-16-5-7-20(8-6-16)9-11-21-12-10-20;;/h3-4,13,16,21-22H,5-12,14H2,1-2H3;2*1H |
| InChIKey | AYUQOPHDCSIMNB-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(1,5-dimethylindazol-3-yl)methyl]-3-azaspiro[5.5]undecan-9-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1,5-dimethylindazol-3-yl)methyl]-3-azaspiro[5.5]undecan-9-amine;dihydrochloride?
The IUPAC name of N-[(1,5-dimethylindazol-3-yl)methyl]-3-azaspiro[5.5]undecan-9-amine;dihydrochloride (CID 154924781) is N-[(1,5-dimethylindazol-3-yl)methyl]-3-azaspiro[5.5]undecan-9-amine;dihydrochloride.
What is the SMILES notation for N-[(1,5-dimethylindazol-3-yl)methyl]-3-azaspiro[5.5]undecan-9-amine;dihydrochloride?
The canonical SMILES for N-[(1,5-dimethylindazol-3-yl)methyl]-3-azaspiro[5.5]undecan-9-amine;dihydrochloride is Cc1ccc2c(c1)c(CNC1CCC3(CCNCC3)CC1)nn2C.Cl.Cl.
What is the InChIKey of N-[(1,5-dimethylindazol-3-yl)methyl]-3-azaspiro[5.5]undecan-9-amine;dihydrochloride?
The InChIKey is AYUQOPHDCSIMNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30N4.2ClH/c1-15-3-4-19-17(13-15)18(23-24(19)2)14-22-16-5-7-20(8-6-16)9-11-21-12-10-20;;/h3-4,13,16,21-22H,5-12,14H2,1-2H3;2*1H.
What are the key properties of N-[(1,5-dimethylindazol-3-yl)methyl]-3-azaspiro[5.5]undecan-9-amine;dihydrochloride?
N-[(1,5-dimethylindazol-3-yl)methyl]-3-azaspiro[5.5]undecan-9-amine;dihydrochloride has a molecular weight of 399.41 g/mol, XLogP of 4.13, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1,5-dimethylindazol-3-yl)methyl]-3-azaspiro[5.5]undecan-9-amine;dihydrochloride is sourced from PubChem (CID 154924781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).