About barium(2+);bis(pyridine-2-sulfonate)
barium(2+);bis(pyridine-2-sulfonate) (PubChem CID 154925532) has the molecular formula C10H8BaN2O6S2
and a molecular weight of 453.64 g/mol. Its IUPAC name is barium(2+);bis(pyridine-2-sulfonate).
Molecular Properties
| Compound Name | barium(2+);bis(pyridine-2-sulfonate) |
| PubChem CID | 154925532 |
| Molecular Formula | C10H8BaN2O6S2 |
| Molecular Weight | 453.64 g/mol |
| Exact Mass | 453.89 |
| IUPAC Name | barium(2+);bis(pyridine-2-sulfonate) |
| SMILES | O=S(=O)([O-])c1ccccn1.O=S(=O)([O-])c1ccccn1.[Ba+2] |
| InChI | InChI=1S/2C5H5NO3S.Ba/c2*7-10(8,9)5-3-1-2-4-6-5;/h2*1-4H,(H,7,8,9);/q;;+2/p-2 |
| InChIKey | VOTYNFIMRFPYHH-UHFFFAOYSA-L |
| XLogP | -0.41 |
| TPSA | 140.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 453.64 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze barium(2+);bis(pyridine-2-sulfonate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);bis(pyridine-2-sulfonate)?
The IUPAC name of barium(2+);bis(pyridine-2-sulfonate) (CID 154925532) is barium(2+);bis(pyridine-2-sulfonate).
What is the SMILES notation for barium(2+);bis(pyridine-2-sulfonate)?
The canonical SMILES for barium(2+);bis(pyridine-2-sulfonate) is O=S(=O)([O-])c1ccccn1.O=S(=O)([O-])c1ccccn1.[Ba+2].
What is the InChIKey of barium(2+);bis(pyridine-2-sulfonate)?
The InChIKey is VOTYNFIMRFPYHH-UHFFFAOYSA-L. The full InChI is InChI=1S/2C5H5NO3S.Ba/c2*7-10(8,9)5-3-1-2-4-6-5;/h2*1-4H,(H,7,8,9);/q;;+2/p-2.
What are the key properties of barium(2+);bis(pyridine-2-sulfonate)?
barium(2+);bis(pyridine-2-sulfonate) has a molecular weight of 453.64 g/mol, XLogP of -0.41, 2 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);bis(pyridine-2-sulfonate) is sourced from PubChem (CID 154925532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).