C7H11F3N2O2 — CID 154926118
4-(1-azaniumylpropan-2-ylamino)-1,1,1-trifluoro-4-oxobut-2-en-2-olate (PubChem CID 154926118) has the molecular formula C7H11F3N2O2 and a molecular weight of 212.17 g/mol. Its IUPAC name is 4-(1-azaniumylpropan-2-ylamino)-1,1,1-trifluoro-4-oxobut-2-en-2-olate.
| Compound Name | 4-(1-azaniumylpropan-2-ylamino)-1,1,1-trifluoro-4-oxobut-2-en-2-olate |
|---|---|
| PubChem CID | 154926118 |
| Molecular Formula | C7H11F3N2O2 |
| Molecular Weight | 212.17 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 4-(1-azaniumylpropan-2-ylamino)-1,1,1-trifluoro-4-oxobut-2-en-2-olate |
| SMILES | CC(C[NH3+])NC(=O)C=C([O-])C(F)(F)F |
| InChI | InChI=1S/C7H11F3N2O2/c1-4(3-11)12-6(14)2-5(13)7(8,9)10/h2,4,13H,3,11H2,1H3,(H,12,14) |
| InChIKey | GKEGLVDBCNATEK-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.17 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|