C20H30O5 — CID 154926385
1-[4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-1,3,5-trihydroxycyclohexa-2,4-dien-1-yl]-2-methylpropan-1-one (PubChem CID 154926385) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is 1-[4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-1,3,5-trihydroxycyclohexa-2,4-dien-1-yl]-2-methylpropan-1-one.
| Compound Name | 1-[4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-1,3,5-trihydroxycyclohexa-2,4-dien-1-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 154926385 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 1-[4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-1,3,5-trihydroxycyclohexa-2,4-dien-1-yl]-2-methylpropan-1-one |
| SMILES | CC(C)=CCC/C(C)=C/COC1=C(O)CC(O)(C(=O)C(C)C)C=C1O |
| InChI | InChI=1S/C20H30O5/c1-13(2)7-6-8-15(5)9-10-25-18-16(21)11-20(24,12-17(18)22)19(23)14(3)4/h7,9,11,14,21-22,24H,6,8,10,12H2,1-5H3/b15-9+ |
| InChIKey | DPVZCYUPMKIUSK-OQLLNIDSSA-N |
| XLogP | 4.27 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|