C32H18N8 — CID 15492639
2-[4-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)phenyl]-1H-imidazo[4,5-f][1,10]phenanthroline (PubChem CID 15492639) has the molecular formula C32H18N8 and a molecular weight of 514.55 g/mol. Its IUPAC name is 2-[4-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)phenyl]-1H-imidazo[4,5-f][1,10]phenanthroline.
| Compound Name | 2-[4-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)phenyl]-1H-imidazo[4,5-f][1,10]phenanthroline |
|---|---|
| PubChem CID | 15492639 |
| Molecular Formula | C32H18N8 |
| Molecular Weight | 514.55 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | 2-[4-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)phenyl]-1H-imidazo[4,5-f][1,10]phenanthroline |
| SMILES | c1cnc2c(c1)c1nc(-c3ccc(-c4nc5c6cccnc6c6ncccc6c5[nH]4)cc3)[nH]c1c1cccnc12 |
| InChI | InChI=1S/C32H18N8/c1-5-19-23(33-13-1)24-20(6-2-14-34-24)28-27(19)37-31(38-28)17-9-11-18(12-10-17)32-39-29-21-7-3-15-35-25(21)26-22(30(29)40-32)8-4-16-36-26/h1-16H,(H,37,38)(H,39,40) |
| InChIKey | FLGPSSWEPWJHPI-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.55 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|