C18H22O7 — CID 154926393
4-hydroxy-4-methyl-6-oxo-2-(4-propan-2-yloxyphenyl)cyclohexane-1,3-dicarboxylic acid (PubChem CID 154926393) has the molecular formula C18H22O7 and a molecular weight of 350.37 g/mol. Its IUPAC name is 4-hydroxy-4-methyl-6-oxo-2-(4-propan-2-yloxyphenyl)cyclohexane-1,3-dicarboxylic acid.
| Compound Name | 4-hydroxy-4-methyl-6-oxo-2-(4-propan-2-yloxyphenyl)cyclohexane-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 154926393 |
| Molecular Formula | C18H22O7 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 4-hydroxy-4-methyl-6-oxo-2-(4-propan-2-yloxyphenyl)cyclohexane-1,3-dicarboxylic acid |
| SMILES | CC(C)Oc1ccc(C2C(C(=O)O)C(=O)CC(C)(O)C2C(=O)O)cc1 |
| InChI | InChI=1S/C18H22O7/c1-9(2)25-11-6-4-10(5-7-11)13-14(16(20)21)12(19)8-18(3,24)15(13)17(22)23/h4-7,9,13-15,24H,8H2,1-3H3,(H,20,21)(H,22,23) |
| InChIKey | GGJFUTGOBCHHLJ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|