C20H32O7 — CID 154926445
(1'S,5'R,16'S)-5'-hydroxyspiro[1,3-dioxolane-2,18'-3,20-dioxabicyclo[14.4.0]icosane]-4',15'-dione (PubChem CID 154926445) has the molecular formula C20H32O7 and a molecular weight of 384.47 g/mol. Its IUPAC name is (1'S,5'R,16'S)-5'-hydroxyspiro[1,3-dioxolane-2,18'-3,20-dioxabicyclo[14.4.0]icosane]-4',15'-dione.
| Compound Name | (1'S,5'R,16'S)-5'-hydroxyspiro[1,3-dioxolane-2,18'-3,20-dioxabicyclo[14.4.0]icosane]-4',15'-dione |
|---|---|
| PubChem CID | 154926445 |
| Molecular Formula | C20H32O7 |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | (1'S,5'R,16'S)-5'-hydroxyspiro[1,3-dioxolane-2,18'-3,20-dioxabicyclo[14.4.0]icosane]-4',15'-dione |
| SMILES | O=C1OC[C@H]2OCC3(C[C@@H]2C(=O)CCCCCCCCC[C@H]1O)OCCO3 |
| InChI | InChI=1S/C20H32O7/c21-16-8-6-4-2-1-3-5-7-9-17(22)19(23)24-13-18-15(16)12-20(14-25-18)26-10-11-27-20/h15,17-18,22H,1-14H2/t15-,17-,18-/m1/s1 |
| InChIKey | BDYWRCPGLBRXFF-KBAYOESNSA-N |
| XLogP | 2.13 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |