C28H31NO5 — CID 154926569
(E)-1-[2-hydroxy-4-prop-2-enoxy-5-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)phenyl]-3-(3-nitrophenyl)prop-2-en-1-one (PubChem CID 154926569) has the molecular formula C28H31NO5 and a molecular weight of 461.56 g/mol. Its IUPAC name is (E)-1-[2-hydroxy-4-prop-2-enoxy-5-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)phenyl]-3-(3-nitrophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[2-hydroxy-4-prop-2-enoxy-5-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)phenyl]-3-(3-nitrophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 154926569 |
| Molecular Formula | C28H31NO5 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | (E)-1-[2-hydroxy-4-prop-2-enoxy-5-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)phenyl]-3-(3-nitrophenyl)prop-2-en-1-one |
| SMILES | C=CCOc1cc(O)c(C(=O)/C=C/c2cccc([N+](=O)[O-])c2)cc1C1CC2CCC1(C)C2(C)C |
| InChI | InChI=1S/C28H31NO5/c1-5-13-34-26-17-25(31)22(24(30)10-9-18-7-6-8-20(14-18)29(32)33)16-21(26)23-15-19-11-12-28(23,4)27(19,2)3/h5-10,14,16-17,19,23,31H,1,11-13,15H2,2-4H3/b10-9+ |
| InChIKey | CBUBUXOCVMACPU-MDZDMXLPSA-N |
| XLogP | 6.69 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|