C22H42F8O6Si2 — CID 154926629
triethoxy-(1,1,2,2,3,3,4,4-octafluoro-10-triethoxysilyldecyl)silane (PubChem CID 154926629) has the molecular formula C22H42F8O6Si2 and a molecular weight of 610.73 g/mol. Its IUPAC name is triethoxy-(1,1,2,2,3,3,4,4-octafluoro-10-triethoxysilyldecyl)silane.
| Compound Name | triethoxy-(1,1,2,2,3,3,4,4-octafluoro-10-triethoxysilyldecyl)silane |
|---|---|
| PubChem CID | 154926629 |
| Molecular Formula | C22H42F8O6Si2 |
| Molecular Weight | 610.73 g/mol |
| Exact Mass | 610.24 |
| IUPAC Name | triethoxy-(1,1,2,2,3,3,4,4-octafluoro-10-triethoxysilyldecyl)silane |
| SMILES | CCO[Si](CCCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)[Si](OCC)(OCC)OCC)(OCC)OCC |
| InChI | InChI=1S/C22H42F8O6Si2/c1-7-31-37(32-8-2,33-9-3)18-16-14-13-15-17-19(23,24)20(25,26)21(27,28)22(29,30)38(34-10-4,35-11-5)36-12-6/h7-18H2,1-6H3 |
| InChIKey | WFSARGSWZVLXFR-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.73 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|