C26H42F16O6Si2 — CID 154926672
triethoxy-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-14-triethoxysilyltetradecyl)silane (PubChem CID 154926672) has the molecular formula C26H42F16O6Si2 and a molecular weight of 810.76 g/mol. Its IUPAC name is triethoxy-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-14-triethoxysilyltetradecyl)silane.
| Compound Name | triethoxy-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-14-triethoxysilyltetradecyl)silane |
|---|---|
| PubChem CID | 154926672 |
| Molecular Formula | C26H42F16O6Si2 |
| Molecular Weight | 810.76 g/mol |
| Exact Mass | 810.23 |
| IUPAC Name | triethoxy-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-14-triethoxysilyltetradecyl)silane |
| SMILES | CCO[Si](CCCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)[Si](OCC)(OCC)OCC)(OCC)OCC |
| InChI | InChI=1S/C26H42F16O6Si2/c1-7-43-49(44-8-2,45-9-3)18-16-14-13-15-17-19(27,28)20(29,30)21(31,32)22(33,34)23(35,36)24(37,38)25(39,40)26(41,42)50(46-10-4,47-11-5)48-12-6/h7-18H2,1-6H3 |
| InChIKey | DEUQGYXPHDHPSB-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.76 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|