About 4-oxatricyclo[4.2.1.03,9]nona-1(9),2,5,7-tetraene
4-oxatricyclo[4.2.1.03,9]nona-1(9),2,5,7-tetraene (PubChem CID 154926700) has the molecular formula C8H4O
and a molecular weight of 116.12 g/mol. Its IUPAC name is 4-oxatricyclo[4.2.1.03,9]nona-1(9),2,5,7-tetraene.
Analyze 4-oxatricyclo[4.2.1.03,9]nona-1(9),2,5,7-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxatricyclo[4.2.1.03,9]nona-1(9),2,5,7-tetraene?
The IUPAC name of 4-oxatricyclo[4.2.1.03,9]nona-1(9),2,5,7-tetraene (CID 154926700) is 4-oxatricyclo[4.2.1.03,9]nona-1(9),2,5,7-tetraene.
What is the SMILES notation for 4-oxatricyclo[4.2.1.03,9]nona-1(9),2,5,7-tetraene?
The canonical SMILES for 4-oxatricyclo[4.2.1.03,9]nona-1(9),2,5,7-tetraene is C1=Cc2coc3c2=C1C=3.
What is the InChIKey of 4-oxatricyclo[4.2.1.03,9]nona-1(9),2,5,7-tetraene?
The InChIKey is TUVWHSYHMIAOKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4O/c1-2-6-4-9-7-3-5(1)8(6)7/h1-4H.
What are the key properties of 4-oxatricyclo[4.2.1.03,9]nona-1(9),2,5,7-tetraene?
4-oxatricyclo[4.2.1.03,9]nona-1(9),2,5,7-tetraene has a molecular weight of 116.12 g/mol, XLogP of 0.25, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxatricyclo[4.2.1.03,9]nona-1(9),2,5,7-tetraene is sourced from PubChem (CID 154926700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).