C41H27N5O — CID 154926811
2-cyclohexa-2,4-dien-1-yl-6-[3-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-[1,3]oxazolo[5,4-k]phenanthridine (PubChem CID 154926811) has the molecular formula C41H27N5O and a molecular weight of 605.70 g/mol. Its IUPAC name is 2-cyclohexa-2,4-dien-1-yl-6-[3-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-[1,3]oxazolo[5,4-k]phenanthridine.
| Compound Name | 2-cyclohexa-2,4-dien-1-yl-6-[3-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-[1,3]oxazolo[5,4-k]phenanthridine |
|---|---|
| PubChem CID | 154926811 |
| Molecular Formula | C41H27N5O |
| Molecular Weight | 605.70 g/mol |
| Exact Mass | 605.22 |
| IUPAC Name | 2-cyclohexa-2,4-dien-1-yl-6-[3-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-[1,3]oxazolo[5,4-k]phenanthridine |
| SMILES | C1=CCC(c2nc3c(ccc4c(-c5cccc(-c6cc(-c7ccccn7)nc(-c7ccccn7)c6)c5)nc5ccccc5c43)o2)C=C1 |
| InChI | InChI=1S/C41H27N5O/c1-2-11-26(12-3-1)41-46-40-37(47-41)20-19-31-38(40)30-15-4-5-16-32(30)45-39(31)28-14-10-13-27(23-28)29-24-35(33-17-6-8-21-42-33)44-36(25-29)34-18-7-9-22-43-34/h1-11,13-26H,12H2 |
| InChIKey | PMVUJCQBKYEERI-UHFFFAOYSA-N |
| XLogP | 9.98 |
| TPSA | 77.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.70 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|