C37H34N4O — CID 154926814
4-(9-cyclohexa-1,3-dien-1-yl-6a,7,8,10a-tetrahydro-1,10-phenanthrolin-2-yl)-2-(2-phenyl-2,3-dihydro-1,3-benzoxazol-4-yl)cyclohexa-2,4-dien-1-amine (PubChem CID 154926814) has the molecular formula C37H34N4O and a molecular weight of 550.71 g/mol. Its IUPAC name is 4-(9-cyclohexa-1,3-dien-1-yl-6a,7,8,10a-tetrahydro-1,10-phenanthrolin-2-yl)-2-(2-phenyl-2,3-dihydro-1,3-benzoxazol-4-yl)cyclohexa-2,4-dien-1-amine.
| Compound Name | 4-(9-cyclohexa-1,3-dien-1-yl-6a,7,8,10a-tetrahydro-1,10-phenanthrolin-2-yl)-2-(2-phenyl-2,3-dihydro-1,3-benzoxazol-4-yl)cyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 154926814 |
| Molecular Formula | C37H34N4O |
| Molecular Weight | 550.71 g/mol |
| Exact Mass | 550.27 |
| IUPAC Name | 4-(9-cyclohexa-1,3-dien-1-yl-6a,7,8,10a-tetrahydro-1,10-phenanthrolin-2-yl)-2-(2-phenyl-2,3-dihydro-1,3-benzoxazol-4-yl)cyclohexa-2,4-dien-1-amine |
| SMILES | NC1CC=C(c2ccc3c(n2)C2N=C(C4=CC=CCC4)CCC2C=C3)C=C1c1cccc2c1NC(c1ccccc1)O2 |
| InChI | InChI=1S/C37H34N4O/c38-30-19-16-27(22-29(30)28-12-7-13-33-36(28)41-37(42-33)26-10-5-2-6-11-26)32-21-18-25-15-14-24-17-20-31(23-8-3-1-4-9-23)39-34(24)35(25)40-32/h1-3,5-8,10-16,18,21-22,24,30,34,37,41H,4,9,17,19-20,38H2 |
| InChIKey | FUPFQAAWILSAOC-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.71 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |