C24H30N2O7 — CID 154926885
(1R,2S,3S,4S,4aR,11bR)-7-[[(Z)-3-cyclobutylprop-2-enyl]-prop-2-enylamino]-1,2,3,4-tetrahydroxy-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-6-one (PubChem CID 154926885) has the molecular formula C24H30N2O7 and a molecular weight of 458.51 g/mol. Its IUPAC name is (1R,2S,3S,4S,4aR,11bR)-7-[[(Z)-3-cyclobutylprop-2-enyl]-prop-2-enylamino]-1,2,3,4-tetrahydroxy-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-6-one.
| Compound Name | (1R,2S,3S,4S,4aR,11bR)-7-[[(Z)-3-cyclobutylprop-2-enyl]-prop-2-enylamino]-1,2,3,4-tetrahydroxy-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-6-one |
|---|---|
| PubChem CID | 154926885 |
| Molecular Formula | C24H30N2O7 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | (1R,2S,3S,4S,4aR,11bR)-7-[[(Z)-3-cyclobutylprop-2-enyl]-prop-2-enylamino]-1,2,3,4-tetrahydroxy-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-6-one |
| SMILES | C=CCN(C/C=C\C1CCC1)c1c2c(cc3c1C(=O)N[C@H]1[C@H](O)[C@H](O)[C@@H](O)[C@H](O)[C@H]31)OCO2 |
| InChI | InChI=1S/C24H30N2O7/c1-2-8-26(9-4-7-12-5-3-6-12)18-16-13(10-14-23(18)33-11-32-14)15-17(25-24(16)31)20(28)22(30)21(29)19(15)27/h2,4,7,10,12,15,17,19-22,27-30H,1,3,5-6,8-9,11H2,(H,25,31)/b7-4-/t15-,17-,19-,20+,21+,22+/m1/s1 |
| InChIKey | VLUBCABKOVZFSH-WOVZKEOQSA-N |
| XLogP | 0.42 |
| TPSA | 131.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|