C60H77F3N2O2 — CID 154927095
7-(3,6-ditert-butylcarbazol-9-yl)-1-[5-[7-(3,6-ditert-butylcarbazol-9-yl)-1-hydroxyheptyl]-2,4,6-trifluorocyclohexa-1,5-dien-1-yl]heptan-1-one (PubChem CID 154927095) has the molecular formula C60H77F3N2O2 and a molecular weight of 915.28 g/mol. Its IUPAC name is 7-(3,6-ditert-butylcarbazol-9-yl)-1-[5-[7-(3,6-ditert-butylcarbazol-9-yl)-1-hydroxyheptyl]-2,4,6-trifluorocyclohexa-1,5-dien-1-yl]heptan-1-one.
| Compound Name | 7-(3,6-ditert-butylcarbazol-9-yl)-1-[5-[7-(3,6-ditert-butylcarbazol-9-yl)-1-hydroxyheptyl]-2,4,6-trifluorocyclohexa-1,5-dien-1-yl]heptan-1-one |
|---|---|
| PubChem CID | 154927095 |
| Molecular Formula | C60H77F3N2O2 |
| Molecular Weight | 915.28 g/mol |
| Exact Mass | 914.59 |
| IUPAC Name | 7-(3,6-ditert-butylcarbazol-9-yl)-1-[5-[7-(3,6-ditert-butylcarbazol-9-yl)-1-hydroxyheptyl]-2,4,6-trifluorocyclohexa-1,5-dien-1-yl]heptan-1-one |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2CCCCCCC(=O)C1=C(F)CC(F)C(C(O)CCCCCCn2c3ccc(C(C)(C)C)cc3c3cc(C(C)(C)C)ccc32)=C1F |
| InChI | InChI=1S/C60H77F3N2O2/c1-57(2,3)38-23-27-48-42(33-38)43-34-39(58(4,5)6)24-28-49(43)64(48)31-19-15-13-17-21-52(66)54-46(61)37-47(62)55(56(54)63)53(67)22-18-14-16-20-32-65-50-29-25-40(59(7,8)9)35-44(50)45-36-41(60(10,11)12)26-30-51(45)65/h23-30,33-36,46,52,66H,13-22,31-32,37H2,1-12H3 |
| InChIKey | KRFDNIVBDSSPTC-UHFFFAOYSA-N |
| XLogP | 16.81 |
| TPSA | 47.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 915.28 |
| LogP ≤ 5 | 16.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|