C10H18N2 — CID 154927210
N-methyl-2-(1,2,3,4-tetrahydropyridin-3-yl)butan-1-imine (PubChem CID 154927210) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is N-methyl-2-(1,2,3,4-tetrahydropyridin-3-yl)butan-1-imine.
| Compound Name | N-methyl-2-(1,2,3,4-tetrahydropyridin-3-yl)butan-1-imine |
|---|---|
| PubChem CID | 154927210 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | N-methyl-2-(1,2,3,4-tetrahydropyridin-3-yl)butan-1-imine |
| SMILES | CCC(/C=N/C)C1CC=CNC1 |
| InChI | InChI=1S/C10H18N2/c1-3-9(7-11-2)10-5-4-6-12-8-10/h4,6-7,9-10,12H,3,5,8H2,1-2H3/b11-7+ |
| InChIKey | OSVBFAMBZRAOCW-YRNVUSSQSA-N |
| XLogP | 1.84 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|