About N-[1-(ethenylamino)ethyl]-N'-ethyl-N-methylcarbamimidoyl fluoride
N-[1-(ethenylamino)ethyl]-N'-ethyl-N-methylcarbamimidoyl fluoride (PubChem CID 154927288) has the molecular formula C8H16FN3
and a molecular weight of 173.23 g/mol. Its IUPAC name is N-[1-(ethenylamino)ethyl]-N'-ethyl-N-methylcarbamimidoyl fluoride.
Molecular Properties
| Compound Name | N-[1-(ethenylamino)ethyl]-N'-ethyl-N-methylcarbamimidoyl fluoride |
| PubChem CID | 154927288 |
| Molecular Formula | C8H16FN3 |
| Molecular Weight | 173.23 g/mol |
| Exact Mass | 173.13 |
| IUPAC Name | N-[1-(ethenylamino)ethyl]-N'-ethyl-N-methylcarbamimidoyl fluoride |
| SMILES | C=CNC(C)N(C)/C(F)=N/CC |
| InChI | InChI=1S/C8H16FN3/c1-5-10-7(3)12(4)8(9)11-6-2/h5,7,10H,1,6H2,2-4H3/b11-8+ |
| InChIKey | ISFDJUNJBLZIHW-DHZHZOJOSA-N |
| XLogP | 1.34 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.23 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-[1-(ethenylamino)ethyl]-N'-ethyl-N-methylcarbamimidoyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(ethenylamino)ethyl]-N'-ethyl-N-methylcarbamimidoyl fluoride?
The IUPAC name of N-[1-(ethenylamino)ethyl]-N'-ethyl-N-methylcarbamimidoyl fluoride (CID 154927288) is N-[1-(ethenylamino)ethyl]-N'-ethyl-N-methylcarbamimidoyl fluoride.
What is the SMILES notation for N-[1-(ethenylamino)ethyl]-N'-ethyl-N-methylcarbamimidoyl fluoride?
The canonical SMILES for N-[1-(ethenylamino)ethyl]-N'-ethyl-N-methylcarbamimidoyl fluoride is C=CNC(C)N(C)/C(F)=N/CC.
What is the InChIKey of N-[1-(ethenylamino)ethyl]-N'-ethyl-N-methylcarbamimidoyl fluoride?
The InChIKey is ISFDJUNJBLZIHW-DHZHZOJOSA-N. The full InChI is InChI=1S/C8H16FN3/c1-5-10-7(3)12(4)8(9)11-6-2/h5,7,10H,1,6H2,2-4H3/b11-8+.
What are the key properties of N-[1-(ethenylamino)ethyl]-N'-ethyl-N-methylcarbamimidoyl fluoride?
N-[1-(ethenylamino)ethyl]-N'-ethyl-N-methylcarbamimidoyl fluoride has a molecular weight of 173.23 g/mol, XLogP of 1.34, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(ethenylamino)ethyl]-N'-ethyl-N-methylcarbamimidoyl fluoride is sourced from PubChem (CID 154927288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).