About 6-tert-butyl-2,6-dimethoxycyclohexa-2,4-dien-1-ol
6-tert-butyl-2,6-dimethoxycyclohexa-2,4-dien-1-ol (PubChem CID 154928153) has the molecular formula C12H20O3
and a molecular weight of 212.29 g/mol. Its IUPAC name is 6-tert-butyl-2,6-dimethoxycyclohexa-2,4-dien-1-ol.
Molecular Properties
| Compound Name | 6-tert-butyl-2,6-dimethoxycyclohexa-2,4-dien-1-ol |
| PubChem CID | 154928153 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 6-tert-butyl-2,6-dimethoxycyclohexa-2,4-dien-1-ol |
| SMILES | COC1=CC=CC(OC)(C(C)(C)C)C1O |
| InChI | InChI=1S/C12H20O3/c1-11(2,3)12(15-5)8-6-7-9(14-4)10(12)13/h6-8,10,13H,1-5H3 |
| InChIKey | RYHMIZOQOZOHDX-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-tert-butyl-2,6-dimethoxycyclohexa-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-2,6-dimethoxycyclohexa-2,4-dien-1-ol?
The IUPAC name of 6-tert-butyl-2,6-dimethoxycyclohexa-2,4-dien-1-ol (CID 154928153) is 6-tert-butyl-2,6-dimethoxycyclohexa-2,4-dien-1-ol.
What is the SMILES notation for 6-tert-butyl-2,6-dimethoxycyclohexa-2,4-dien-1-ol?
The canonical SMILES for 6-tert-butyl-2,6-dimethoxycyclohexa-2,4-dien-1-ol is COC1=CC=CC(OC)(C(C)(C)C)C1O.
What is the InChIKey of 6-tert-butyl-2,6-dimethoxycyclohexa-2,4-dien-1-ol?
The InChIKey is RYHMIZOQOZOHDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O3/c1-11(2,3)12(15-5)8-6-7-9(14-4)10(12)13/h6-8,10,13H,1-5H3.
What are the key properties of 6-tert-butyl-2,6-dimethoxycyclohexa-2,4-dien-1-ol?
6-tert-butyl-2,6-dimethoxycyclohexa-2,4-dien-1-ol has a molecular weight of 212.29 g/mol, XLogP of 1.88, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-2,6-dimethoxycyclohexa-2,4-dien-1-ol is sourced from PubChem (CID 154928153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).