C11H17F9N2O2S — CID 154928654
N-[2-(diethylamino)propyl]-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide (PubChem CID 154928654) has the molecular formula C11H17F9N2O2S and a molecular weight of 412.32 g/mol. Its IUPAC name is N-[2-(diethylamino)propyl]-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide.
| Compound Name | N-[2-(diethylamino)propyl]-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide |
|---|---|
| PubChem CID | 154928654 |
| Molecular Formula | C11H17F9N2O2S |
| Molecular Weight | 412.32 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | N-[2-(diethylamino)propyl]-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide |
| SMILES | CCN(CC)C(C)CNS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H17F9N2O2S/c1-4-22(5-2)7(3)6-21-25(23,24)11(19,20)9(14,15)8(12,13)10(16,17)18/h7,21H,4-6H2,1-3H3 |
| InChIKey | DCMXSERVXDHKOE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|