About 4-[(3-bromo-5-fluorophenyl)methylidene]pyrrolidine-1,2-dicarboxylic acid
4-[(3-bromo-5-fluorophenyl)methylidene]pyrrolidine-1,2-dicarboxylic acid (PubChem CID 154928761) has the molecular formula C13H11BrFNO4
and a molecular weight of 344.14 g/mol. Its IUPAC name is 4-[(3-bromo-5-fluorophenyl)methylidene]pyrrolidine-1,2-dicarboxylic acid.
Molecular Properties
| Compound Name | 4-[(3-bromo-5-fluorophenyl)methylidene]pyrrolidine-1,2-dicarboxylic acid |
| PubChem CID | 154928761 |
| Molecular Formula | C13H11BrFNO4 |
| Molecular Weight | 344.14 g/mol |
| Exact Mass | 342.99 |
| IUPAC Name | 4-[(3-bromo-5-fluorophenyl)methylidene]pyrrolidine-1,2-dicarboxylic acid |
| SMILES | O=C(O)C1CC(=Cc2cc(F)cc(Br)c2)CN1C(=O)O |
| InChI | InChI=1S/C13H11BrFNO4/c14-9-2-7(3-10(15)5-9)1-8-4-11(12(17)18)16(6-8)13(19)20/h1-3,5,11H,4,6H2,(H,17,18)(H,19,20) |
| InChIKey | AIIKBPGTRXCDPL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.14 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[(3-bromo-5-fluorophenyl)methylidene]pyrrolidine-1,2-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3-bromo-5-fluorophenyl)methylidene]pyrrolidine-1,2-dicarboxylic acid?
The IUPAC name of 4-[(3-bromo-5-fluorophenyl)methylidene]pyrrolidine-1,2-dicarboxylic acid (CID 154928761) is 4-[(3-bromo-5-fluorophenyl)methylidene]pyrrolidine-1,2-dicarboxylic acid.
What is the SMILES notation for 4-[(3-bromo-5-fluorophenyl)methylidene]pyrrolidine-1,2-dicarboxylic acid?
The canonical SMILES for 4-[(3-bromo-5-fluorophenyl)methylidene]pyrrolidine-1,2-dicarboxylic acid is O=C(O)C1CC(=Cc2cc(F)cc(Br)c2)CN1C(=O)O.
What is the InChIKey of 4-[(3-bromo-5-fluorophenyl)methylidene]pyrrolidine-1,2-dicarboxylic acid?
The InChIKey is AIIKBPGTRXCDPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11BrFNO4/c14-9-2-7(3-10(15)5-9)1-8-4-11(12(17)18)16(6-8)13(19)20/h1-3,5,11H,4,6H2,(H,17,18)(H,19,20).
What are the key properties of 4-[(3-bromo-5-fluorophenyl)methylidene]pyrrolidine-1,2-dicarboxylic acid?
4-[(3-bromo-5-fluorophenyl)methylidene]pyrrolidine-1,2-dicarboxylic acid has a molecular weight of 344.14 g/mol, XLogP of 2.81, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3-bromo-5-fluorophenyl)methylidene]pyrrolidine-1,2-dicarboxylic acid is sourced from PubChem (CID 154928761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).