C6H11N3O2S — CID 154929034
2-(diaziridin-3-ylideneamino)-4-methylsulfanylbutanoic acid (PubChem CID 154929034) has the molecular formula C6H11N3O2S and a molecular weight of 189.24 g/mol. Its IUPAC name is 2-(diaziridin-3-ylideneamino)-4-methylsulfanylbutanoic acid.
| Compound Name | 2-(diaziridin-3-ylideneamino)-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 154929034 |
| Molecular Formula | C6H11N3O2S |
| Molecular Weight | 189.24 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | 2-(diaziridin-3-ylideneamino)-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(N=C1NN1)C(=O)O |
| InChI | InChI=1S/C6H11N3O2S/c1-12-3-2-4(5(10)11)7-6-8-9-6/h4H,2-3H2,1H3,(H,10,11)(H2,7,8,9) |
| InChIKey | YKCZCJBICLJWBU-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 93.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.24 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|