C18F15Ga — CID 15492934
tris(2,3,4,5,6-pentafluorophenyl)gallane (PubChem CID 15492934) has the molecular formula C18F15Ga and a molecular weight of 570.89 g/mol. Its IUPAC name is tris(2,3,4,5,6-pentafluorophenyl)gallane.
| Compound Name | tris(2,3,4,5,6-pentafluorophenyl)gallane |
|---|---|
| PubChem CID | 15492934 |
| Molecular Formula | C18F15Ga |
| Molecular Weight | 570.89 g/mol |
| Exact Mass | 569.90 |
| IUPAC Name | tris(2,3,4,5,6-pentafluorophenyl)gallane |
| SMILES | Fc1c(F)c(F)c([Ga](c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/3C6F5.Ga/c3*7-2-1-3(8)5(10)6(11)4(2)9; |
| InChIKey | PRRYCPZRJOKSOX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.89 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|