About 2-ethenyl-3-[(3Z)-2-methylhexa-3,5-dien-3-yl]-1H-pyrrole
2-ethenyl-3-[(3Z)-2-methylhexa-3,5-dien-3-yl]-1H-pyrrole (PubChem CID 154929979) has the molecular formula C13H17N
and a molecular weight of 187.29 g/mol. Its IUPAC name is 2-ethenyl-3-[(3Z)-2-methylhexa-3,5-dien-3-yl]-1H-pyrrole.
Molecular Properties
| Compound Name | 2-ethenyl-3-[(3Z)-2-methylhexa-3,5-dien-3-yl]-1H-pyrrole |
| PubChem CID | 154929979 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 2-ethenyl-3-[(3Z)-2-methylhexa-3,5-dien-3-yl]-1H-pyrrole |
| SMILES | C=C/C=C(\c1cc[nH]c1C=C)C(C)C |
| InChI | InChI=1S/C13H17N/c1-5-7-11(10(3)4)12-8-9-14-13(12)6-2/h5-10,14H,1-2H2,3-4H3/b11-7- |
| InChIKey | KOEJQSBVKSHNNX-XFFZJAGNSA-N |
| XLogP | 3.88 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenyl-3-[(3Z)-2-methylhexa-3,5-dien-3-yl]-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-3-[(3Z)-2-methylhexa-3,5-dien-3-yl]-1H-pyrrole?
The IUPAC name of 2-ethenyl-3-[(3Z)-2-methylhexa-3,5-dien-3-yl]-1H-pyrrole (CID 154929979) is 2-ethenyl-3-[(3Z)-2-methylhexa-3,5-dien-3-yl]-1H-pyrrole.
What is the SMILES notation for 2-ethenyl-3-[(3Z)-2-methylhexa-3,5-dien-3-yl]-1H-pyrrole?
The canonical SMILES for 2-ethenyl-3-[(3Z)-2-methylhexa-3,5-dien-3-yl]-1H-pyrrole is C=C/C=C(\c1cc[nH]c1C=C)C(C)C.
What is the InChIKey of 2-ethenyl-3-[(3Z)-2-methylhexa-3,5-dien-3-yl]-1H-pyrrole?
The InChIKey is KOEJQSBVKSHNNX-XFFZJAGNSA-N. The full InChI is InChI=1S/C13H17N/c1-5-7-11(10(3)4)12-8-9-14-13(12)6-2/h5-10,14H,1-2H2,3-4H3/b11-7-.
What are the key properties of 2-ethenyl-3-[(3Z)-2-methylhexa-3,5-dien-3-yl]-1H-pyrrole?
2-ethenyl-3-[(3Z)-2-methylhexa-3,5-dien-3-yl]-1H-pyrrole has a molecular weight of 187.29 g/mol, XLogP of 3.88, 4 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-3-[(3Z)-2-methylhexa-3,5-dien-3-yl]-1H-pyrrole is sourced from PubChem (CID 154929979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).