About (Z)-N'-ethenyl-6-methylsulfanyl-3-prop-2-enyloct-1-ene-1,8-diamine
(Z)-N'-ethenyl-6-methylsulfanyl-3-prop-2-enyloct-1-ene-1,8-diamine (PubChem CID 154930359) has the molecular formula C14H26N2S
and a molecular weight of 254.44 g/mol. Its IUPAC name is (Z)-N'-ethenyl-6-methylsulfanyl-3-prop-2-enyloct-1-ene-1,8-diamine.
Molecular Properties
| Compound Name | (Z)-N'-ethenyl-6-methylsulfanyl-3-prop-2-enyloct-1-ene-1,8-diamine |
| PubChem CID | 154930359 |
| Molecular Formula | C14H26N2S |
| Molecular Weight | 254.44 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | (Z)-N'-ethenyl-6-methylsulfanyl-3-prop-2-enyloct-1-ene-1,8-diamine |
| SMILES | C=CCC(/C=C\N)CCC(CCNC=C)SC |
| InChI | InChI=1S/C14H26N2S/c1-4-6-13(9-11-15)7-8-14(17-3)10-12-16-5-2/h4-5,9,11,13-14,16H,1-2,6-8,10,12,15H2,3H3/b11-9- |
| InChIKey | YAQSUHQJJRFGOF-LUAWRHEFSA-N |
| XLogP | 3.29 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N'-ethenyl-6-methylsulfanyl-3-prop-2-enyloct-1-ene-1,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N'-ethenyl-6-methylsulfanyl-3-prop-2-enyloct-1-ene-1,8-diamine?
The IUPAC name of (Z)-N'-ethenyl-6-methylsulfanyl-3-prop-2-enyloct-1-ene-1,8-diamine (CID 154930359) is (Z)-N'-ethenyl-6-methylsulfanyl-3-prop-2-enyloct-1-ene-1,8-diamine.
What is the SMILES notation for (Z)-N'-ethenyl-6-methylsulfanyl-3-prop-2-enyloct-1-ene-1,8-diamine?
The canonical SMILES for (Z)-N'-ethenyl-6-methylsulfanyl-3-prop-2-enyloct-1-ene-1,8-diamine is C=CCC(/C=C\N)CCC(CCNC=C)SC.
What is the InChIKey of (Z)-N'-ethenyl-6-methylsulfanyl-3-prop-2-enyloct-1-ene-1,8-diamine?
The InChIKey is YAQSUHQJJRFGOF-LUAWRHEFSA-N. The full InChI is InChI=1S/C14H26N2S/c1-4-6-13(9-11-15)7-8-14(17-3)10-12-16-5-2/h4-5,9,11,13-14,16H,1-2,6-8,10,12,15H2,3H3/b11-9-.
What are the key properties of (Z)-N'-ethenyl-6-methylsulfanyl-3-prop-2-enyloct-1-ene-1,8-diamine?
(Z)-N'-ethenyl-6-methylsulfanyl-3-prop-2-enyloct-1-ene-1,8-diamine has a molecular weight of 254.44 g/mol, XLogP of 3.29, 11 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N'-ethenyl-6-methylsulfanyl-3-prop-2-enyloct-1-ene-1,8-diamine is sourced from PubChem (CID 154930359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).