About 5-chloro-N-(oxiran-2-yl)pyrazolo[1,5-a]pyrimidin-3-amine
5-chloro-N-(oxiran-2-yl)pyrazolo[1,5-a]pyrimidin-3-amine (PubChem CID 154930590) has the molecular formula C8H7ClN4O
and a molecular weight of 210.62 g/mol. Its IUPAC name is 5-chloro-N-(oxiran-2-yl)pyrazolo[1,5-a]pyrimidin-3-amine.
Molecular Properties
| Compound Name | 5-chloro-N-(oxiran-2-yl)pyrazolo[1,5-a]pyrimidin-3-amine |
| PubChem CID | 154930590 |
| Molecular Formula | C8H7ClN4O |
| Molecular Weight | 210.62 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | 5-chloro-N-(oxiran-2-yl)pyrazolo[1,5-a]pyrimidin-3-amine |
| SMILES | Clc1ccn2ncc(NC3CO3)c2n1 |
| InChI | InChI=1S/C8H7ClN4O/c9-6-1-2-13-8(12-6)5(3-10-13)11-7-4-14-7/h1-3,7,11H,4H2 |
| InChIKey | RKOAHMHCTQVXFF-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 54.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.62 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-N-(oxiran-2-yl)pyrazolo[1,5-a]pyrimidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N-(oxiran-2-yl)pyrazolo[1,5-a]pyrimidin-3-amine?
The IUPAC name of 5-chloro-N-(oxiran-2-yl)pyrazolo[1,5-a]pyrimidin-3-amine (CID 154930590) is 5-chloro-N-(oxiran-2-yl)pyrazolo[1,5-a]pyrimidin-3-amine.
What is the SMILES notation for 5-chloro-N-(oxiran-2-yl)pyrazolo[1,5-a]pyrimidin-3-amine?
The canonical SMILES for 5-chloro-N-(oxiran-2-yl)pyrazolo[1,5-a]pyrimidin-3-amine is Clc1ccn2ncc(NC3CO3)c2n1.
What is the InChIKey of 5-chloro-N-(oxiran-2-yl)pyrazolo[1,5-a]pyrimidin-3-amine?
The InChIKey is RKOAHMHCTQVXFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClN4O/c9-6-1-2-13-8(12-6)5(3-10-13)11-7-4-14-7/h1-3,7,11H,4H2.
What are the key properties of 5-chloro-N-(oxiran-2-yl)pyrazolo[1,5-a]pyrimidin-3-amine?
5-chloro-N-(oxiran-2-yl)pyrazolo[1,5-a]pyrimidin-3-amine has a molecular weight of 210.62 g/mol, XLogP of 1.15, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-(oxiran-2-yl)pyrazolo[1,5-a]pyrimidin-3-amine is sourced from PubChem (CID 154930590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).