C16H26O4 — CID 154930702
(3R,4S)-4-ethyl-4-[(2E,4Z)-6-methoxyhexa-2,4-dien-3-yl]-2,2-dimethyloxolane-3-carboxylic acid (PubChem CID 154930702) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is (3R,4S)-4-ethyl-4-[(2E,4Z)-6-methoxyhexa-2,4-dien-3-yl]-2,2-dimethyloxolane-3-carboxylic acid.
| Compound Name | (3R,4S)-4-ethyl-4-[(2E,4Z)-6-methoxyhexa-2,4-dien-3-yl]-2,2-dimethyloxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 154930702 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | (3R,4S)-4-ethyl-4-[(2E,4Z)-6-methoxyhexa-2,4-dien-3-yl]-2,2-dimethyloxolane-3-carboxylic acid |
| SMILES | C/C=C(\C=C/COC)[C@@]1(CC)COC(C)(C)[C@@H]1C(=O)O |
| InChI | InChI=1S/C16H26O4/c1-6-12(9-8-10-19-5)16(7-2)11-20-15(3,4)13(16)14(17)18/h6,8-9,13H,7,10-11H2,1-5H3,(H,17,18)/b9-8-,12-6+/t13-,16+/m0/s1 |
| InChIKey | NQQUJRIZOZJPQL-XOYZXSBDSA-N |
| XLogP | 3.04 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|