C16H25NO — CID 154930705
(4Z,6Z)-5,7-dimethyl-6-(5-methylpyrrolidin-3-yl)nona-4,6,8-trien-2-one (PubChem CID 154930705) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is (4Z,6Z)-5,7-dimethyl-6-(5-methylpyrrolidin-3-yl)nona-4,6,8-trien-2-one.
| Compound Name | (4Z,6Z)-5,7-dimethyl-6-(5-methylpyrrolidin-3-yl)nona-4,6,8-trien-2-one |
|---|---|
| PubChem CID | 154930705 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | (4Z,6Z)-5,7-dimethyl-6-(5-methylpyrrolidin-3-yl)nona-4,6,8-trien-2-one |
| SMILES | C=C/C(C)=C(C(\C)=C/CC(C)=O)/C1CNC(C)C1 |
| InChI | InChI=1S/C16H25NO/c1-6-11(2)16(12(3)7-8-14(5)18)15-9-13(4)17-10-15/h6-7,13,15,17H,1,8-10H2,2-5H3/b12-7-,16-11+ |
| InChIKey | KIEIVWFWQYPQLJ-MZDKLRNXSA-N |
| XLogP | 3.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|