About (4Z)-4-N,5-N-dimethylbicyclo[6.1.0]non-4-ene-4,5-diamine
(4Z)-4-N,5-N-dimethylbicyclo[6.1.0]non-4-ene-4,5-diamine (PubChem CID 154931613) has the molecular formula C11H20N2
and a molecular weight of 180.30 g/mol. Its IUPAC name is (4Z)-4-N,5-N-dimethylbicyclo[6.1.0]non-4-ene-4,5-diamine.
Molecular Properties
| Compound Name | (4Z)-4-N,5-N-dimethylbicyclo[6.1.0]non-4-ene-4,5-diamine |
| PubChem CID | 154931613 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.30 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | (4Z)-4-N,5-N-dimethylbicyclo[6.1.0]non-4-ene-4,5-diamine |
| SMILES | CN/C1=C(\NC)CCC2CC2CC1 |
| InChI | InChI=1S/C11H20N2/c1-12-10-5-3-8-7-9(8)4-6-11(10)13-2/h8-9,12-13H,3-7H2,1-2H3/b11-10- |
| InChIKey | LHWOCISNJLETGT-KHPPLWFESA-N |
| XLogP | 1.85 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.30 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4Z)-4-N,5-N-dimethylbicyclo[6.1.0]non-4-ene-4,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-4-N,5-N-dimethylbicyclo[6.1.0]non-4-ene-4,5-diamine?
The IUPAC name of (4Z)-4-N,5-N-dimethylbicyclo[6.1.0]non-4-ene-4,5-diamine (CID 154931613) is (4Z)-4-N,5-N-dimethylbicyclo[6.1.0]non-4-ene-4,5-diamine.
What is the SMILES notation for (4Z)-4-N,5-N-dimethylbicyclo[6.1.0]non-4-ene-4,5-diamine?
The canonical SMILES for (4Z)-4-N,5-N-dimethylbicyclo[6.1.0]non-4-ene-4,5-diamine is CN/C1=C(\NC)CCC2CC2CC1.
What is the InChIKey of (4Z)-4-N,5-N-dimethylbicyclo[6.1.0]non-4-ene-4,5-diamine?
The InChIKey is LHWOCISNJLETGT-KHPPLWFESA-N. The full InChI is InChI=1S/C11H20N2/c1-12-10-5-3-8-7-9(8)4-6-11(10)13-2/h8-9,12-13H,3-7H2,1-2H3/b11-10-.
What are the key properties of (4Z)-4-N,5-N-dimethylbicyclo[6.1.0]non-4-ene-4,5-diamine?
(4Z)-4-N,5-N-dimethylbicyclo[6.1.0]non-4-ene-4,5-diamine has a molecular weight of 180.30 g/mol, XLogP of 1.85, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-4-N,5-N-dimethylbicyclo[6.1.0]non-4-ene-4,5-diamine is sourced from PubChem (CID 154931613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).