C12H20N2 — CID 154932170
N'-methyl-N-[(3E,5Z)-3-methylocta-3,5,7-trien-4-yl]ethanimidamide (PubChem CID 154932170) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is N'-methyl-N-[(3E,5Z)-3-methylocta-3,5,7-trien-4-yl]ethanimidamide.
| Compound Name | N'-methyl-N-[(3E,5Z)-3-methylocta-3,5,7-trien-4-yl]ethanimidamide |
|---|---|
| PubChem CID | 154932170 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | N'-methyl-N-[(3E,5Z)-3-methylocta-3,5,7-trien-4-yl]ethanimidamide |
| SMILES | C=C/C=C\C(N/C(C)=N/C)=C(\C)CC |
| InChI | InChI=1S/C12H20N2/c1-6-8-9-12(10(3)7-2)14-11(4)13-5/h6,8-9H,1,7H2,2-5H3,(H,13,14)/b9-8-,12-10+ |
| InChIKey | ZQCTVNKXDSAQJE-LVQHWDRTSA-N |
| XLogP | 3.05 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|