C64H46N3OP — CID 154932316
2-[(1Z)-buta-1,3-dienyl]-9-[7-(4-diphenylphosphorylphenyl)-9,9-diphenylfluoren-2-yl]-3-methyl-5-phenylimidazo[1,2-c]quinazoline (PubChem CID 154932316) has the molecular formula C64H46N3OP and a molecular weight of 904.07 g/mol. Its IUPAC name is 2-[(1Z)-buta-1,3-dienyl]-9-[7-(4-diphenylphosphorylphenyl)-9,9-diphenylfluoren-2-yl]-3-methyl-5-phenylimidazo[1,2-c]quinazoline.
| Compound Name | 2-[(1Z)-buta-1,3-dienyl]-9-[7-(4-diphenylphosphorylphenyl)-9,9-diphenylfluoren-2-yl]-3-methyl-5-phenylimidazo[1,2-c]quinazoline |
|---|---|
| PubChem CID | 154932316 |
| Molecular Formula | C64H46N3OP |
| Molecular Weight | 904.07 g/mol |
| Exact Mass | 903.34 |
| IUPAC Name | 2-[(1Z)-buta-1,3-dienyl]-9-[7-(4-diphenylphosphorylphenyl)-9,9-diphenylfluoren-2-yl]-3-methyl-5-phenylimidazo[1,2-c]quinazoline |
| SMILES | C=C/C=C\c1nc2c3cc(-c4ccc5c(c4)C(c4ccccc4)(c4ccccc4)c4cc(-c6ccc(P(=O)(c7ccccc7)c7ccccc7)cc6)ccc4-5)ccc3nc(-c3ccccc3)n2c1C |
| InChI | InChI=1S/C64H46N3OP/c1-3-4-30-60-44(2)67-62(46-20-10-5-11-21-46)66-61-40-35-47(41-57(61)63(67)65-60)49-34-39-56-55-38-33-48(42-58(55)64(59(56)43-49,50-22-12-6-13-23-50)51-24-14-7-15-25-51)45-31-36-54(37-32-45)69(68,52-26-16-8-17-27-52)53-28-18-9-19-29-53/h3-43H,1H2,2H3/b30-4- |
| InChIKey | BCFGPIUBZOBBIP-JBXBRNPSSA-N |
| XLogP | 14.39 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 904.07 |
| LogP ≤ 5 | 14.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|