C29H48N4O4 — CID 154932356
(4E,6Z)-2-(dimethylamino)-N-[3,3-dimethyl-1-[methyl-[(E)-3-methyl-4-oxo-4-(4-oxobutylamino)but-2-enyl]amino]-1-oxobutan-2-yl]-3,3-dimethylnona-4,6,8-trienamide (PubChem CID 154932356) has the molecular formula C29H48N4O4 and a molecular weight of 516.73 g/mol. Its IUPAC name is (4E,6Z)-2-(dimethylamino)-N-[3,3-dimethyl-1-[methyl-[(E)-3-methyl-4-oxo-4-(4-oxobutylamino)but-2-enyl]amino]-1-oxobutan-2-yl]-3,3-dimethylnona-4,6,8-trienamide.
| Compound Name | (4E,6Z)-2-(dimethylamino)-N-[3,3-dimethyl-1-[methyl-[(E)-3-methyl-4-oxo-4-(4-oxobutylamino)but-2-enyl]amino]-1-oxobutan-2-yl]-3,3-dimethylnona-4,6,8-trienamide |
|---|---|
| PubChem CID | 154932356 |
| Molecular Formula | C29H48N4O4 |
| Molecular Weight | 516.73 g/mol |
| Exact Mass | 516.37 |
| IUPAC Name | (4E,6Z)-2-(dimethylamino)-N-[3,3-dimethyl-1-[methyl-[(E)-3-methyl-4-oxo-4-(4-oxobutylamino)but-2-enyl]amino]-1-oxobutan-2-yl]-3,3-dimethylnona-4,6,8-trienamide |
| SMILES | C=C/C=C\C=C\C(C)(C)C(C(=O)NC(C(=O)N(C)C/C=C(\C)C(=O)NCCCC=O)C(C)(C)C)N(C)C |
| InChI | InChI=1S/C29H48N4O4/c1-11-12-13-14-18-29(6,7)24(32(8)9)26(36)31-23(28(3,4)5)27(37)33(10)20-17-22(2)25(35)30-19-15-16-21-34/h11-14,17-18,21,23-24H,1,15-16,19-20H2,2-10H3,(H,30,35)(H,31,36)/b13-12-,18-14+,22-17+ |
| InChIKey | HZDAAMGOZREKJR-CXPHXRGOSA-N |
| XLogP | 3.27 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.73 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|