C54H40N4 — CID 154932509
4-[3-[3-[5-[(2E,4Z)-hepta-2,4,6-trien-2-yl]pyrido[3,2-b]indol-2-yl]carbazol-9-yl]phenyl]-N,N-diphenylaniline (PubChem CID 154932509) has the molecular formula C54H40N4 and a molecular weight of 744.94 g/mol. Its IUPAC name is 4-[3-[3-[5-[(2E,4Z)-hepta-2,4,6-trien-2-yl]pyrido[3,2-b]indol-2-yl]carbazol-9-yl]phenyl]-N,N-diphenylaniline.
| Compound Name | 4-[3-[3-[5-[(2E,4Z)-hepta-2,4,6-trien-2-yl]pyrido[3,2-b]indol-2-yl]carbazol-9-yl]phenyl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 154932509 |
| Molecular Formula | C54H40N4 |
| Molecular Weight | 744.94 g/mol |
| Exact Mass | 744.33 |
| IUPAC Name | 4-[3-[3-[5-[(2E,4Z)-hepta-2,4,6-trien-2-yl]pyrido[3,2-b]indol-2-yl]carbazol-9-yl]phenyl]-N,N-diphenylaniline |
| SMILES | C=C/C=C\C=C(/C)n1c2ccccc2c2nc(-c3ccc4c(c3)c3ccccc3n4-c3cccc(-c4ccc(N(c5ccccc5)c5ccccc5)cc4)c3)ccc21 |
| InChI | InChI=1S/C54H40N4/c1-3-4-7-17-38(2)56-51-27-15-13-25-47(51)54-53(56)35-33-49(55-54)41-30-34-52-48(37-41)46-24-12-14-26-50(46)58(52)45-23-16-18-40(36-45)39-28-31-44(32-29-39)57(42-19-8-5-9-20-42)43-21-10-6-11-22-43/h3-37H,1H2,2H3/b7-4-,38-17+ |
| InChIKey | SHCVELPXPYRHGR-JRJRKTQVSA-N |
| XLogP | 14.69 |
| TPSA | 25.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.94 |
| LogP ≤ 5 | 14.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|