C17H13F10N3 — CID 15493264
N'-methyl-N'-[2-(2,3,4,5,6-pentafluoroanilino)ethyl]-N-(2,3,4,5,6-pentafluorophenyl)ethane-1,2-diamine (PubChem CID 15493264) has the molecular formula C17H13F10N3 and a molecular weight of 449.29 g/mol. Its IUPAC name is N'-methyl-N'-[2-(2,3,4,5,6-pentafluoroanilino)ethyl]-N-(2,3,4,5,6-pentafluorophenyl)ethane-1,2-diamine.
| Compound Name | N'-methyl-N'-[2-(2,3,4,5,6-pentafluoroanilino)ethyl]-N-(2,3,4,5,6-pentafluorophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 15493264 |
| Molecular Formula | C17H13F10N3 |
| Molecular Weight | 449.29 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | N'-methyl-N'-[2-(2,3,4,5,6-pentafluoroanilino)ethyl]-N-(2,3,4,5,6-pentafluorophenyl)ethane-1,2-diamine |
| SMILES | CN(CCNc1c(F)c(F)c(F)c(F)c1F)CCNc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C17H13F10N3/c1-30(4-2-28-16-12(24)8(20)6(18)9(21)13(16)25)5-3-29-17-14(26)10(22)7(19)11(23)15(17)27/h28-29H,2-5H2,1H3 |
| InChIKey | BFCAUVZIVKKODJ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.29 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|