C15H16F6N6OS2 — CID 154933025
1-[(E)-[(1E)-1-(4-hydroxyphenyl)-1-(2,2,2-trifluoroethylcarbamothioylhydrazinylidene)propan-2-ylidene]amino]-3-(2,2,2-trifluoroethyl)thiourea (PubChem CID 154933025) has the molecular formula C15H16F6N6OS2 and a molecular weight of 474.46 g/mol. Its IUPAC name is 1-[(E)-[(1E)-1-(4-hydroxyphenyl)-1-(2,2,2-trifluoroethylcarbamothioylhydrazinylidene)propan-2-ylidene]amino]-3-(2,2,2-trifluoroethyl)thiourea.
| Compound Name | 1-[(E)-[(1E)-1-(4-hydroxyphenyl)-1-(2,2,2-trifluoroethylcarbamothioylhydrazinylidene)propan-2-ylidene]amino]-3-(2,2,2-trifluoroethyl)thiourea |
|---|---|
| PubChem CID | 154933025 |
| Molecular Formula | C15H16F6N6OS2 |
| Molecular Weight | 474.46 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | 1-[(E)-[(1E)-1-(4-hydroxyphenyl)-1-(2,2,2-trifluoroethylcarbamothioylhydrazinylidene)propan-2-ylidene]amino]-3-(2,2,2-trifluoroethyl)thiourea |
| SMILES | CC(=N\NC(=S)NCC(F)(F)F)/C(=N/NC(=S)NCC(F)(F)F)c1ccc(O)cc1 |
| InChI | InChI=1S/C15H16F6N6OS2/c1-8(24-26-12(29)22-6-14(16,17)18)11(9-2-4-10(28)5-3-9)25-27-13(30)23-7-15(19,20)21/h2-5,28H,6-7H2,1H3,(H2,22,26,29)(H2,23,27,30)/b24-8+,25-11- |
| InChIKey | SXYUPHIHZAHACQ-DQFOEZETSA-N |
| XLogP | 2.53 |
| TPSA | 93.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.46 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|