C15H19F3N6OS2 — CID 154933042
1-ethyl-3-[(E)-[(2E)-1-(4-hydroxyphenyl)-2-(2,2,2-trifluoroethylcarbamothioylhydrazinylidene)propylidene]amino]thiourea (PubChem CID 154933042) has the molecular formula C15H19F3N6OS2 and a molecular weight of 420.49 g/mol. Its IUPAC name is 1-ethyl-3-[(E)-[(2E)-1-(4-hydroxyphenyl)-2-(2,2,2-trifluoroethylcarbamothioylhydrazinylidene)propylidene]amino]thiourea.
| Compound Name | 1-ethyl-3-[(E)-[(2E)-1-(4-hydroxyphenyl)-2-(2,2,2-trifluoroethylcarbamothioylhydrazinylidene)propylidene]amino]thiourea |
|---|---|
| PubChem CID | 154933042 |
| Molecular Formula | C15H19F3N6OS2 |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | 1-ethyl-3-[(E)-[(2E)-1-(4-hydroxyphenyl)-2-(2,2,2-trifluoroethylcarbamothioylhydrazinylidene)propylidene]amino]thiourea |
| SMILES | CCNC(=S)N/N=C(C(/C)=N/NC(=S)NCC(F)(F)F)\c1ccc(O)cc1 |
| InChI | InChI=1S/C15H19F3N6OS2/c1-3-19-13(26)24-22-12(10-4-6-11(25)7-5-10)9(2)21-23-14(27)20-8-15(16,17)18/h4-7,25H,3,8H2,1-2H3,(H2,19,24,26)(H2,20,23,27)/b21-9+,22-12- |
| InChIKey | DGICKSFHNGIZQR-XFMFAQHNSA-N |
| XLogP | 1.98 |
| TPSA | 93.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|