C10H13F8O3P — CID 154933847
[4,5,5-trifluoro-5-(3,3,4,4,4-pentafluorobutoxy)-4-phosphanylpentyl] formate (PubChem CID 154933847) has the molecular formula C10H13F8O3P and a molecular weight of 364.17 g/mol. Its IUPAC name is [4,5,5-trifluoro-5-(3,3,4,4,4-pentafluorobutoxy)-4-phosphanylpentyl] formate.
| Compound Name | [4,5,5-trifluoro-5-(3,3,4,4,4-pentafluorobutoxy)-4-phosphanylpentyl] formate |
|---|---|
| PubChem CID | 154933847 |
| Molecular Formula | C10H13F8O3P |
| Molecular Weight | 364.17 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | [4,5,5-trifluoro-5-(3,3,4,4,4-pentafluorobutoxy)-4-phosphanylpentyl] formate |
| SMILES | O=COCCCC(F)(P)C(F)(F)OCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H13F8O3P/c11-7(12,9(14,15)16)3-5-21-10(17,18)8(13,22)2-1-4-20-6-19/h6H,1-5,22H2 |
| InChIKey | KOCJITJOCOGPKX-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.17 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|