C26H36O3 — CID 154934626
(2S)-2-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-methyl-7-pentylchromene-5,8-dione (PubChem CID 154934626) has the molecular formula C26H36O3 and a molecular weight of 396.57 g/mol. Its IUPAC name is (2S)-2-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-methyl-7-pentylchromene-5,8-dione.
| Compound Name | (2S)-2-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-methyl-7-pentylchromene-5,8-dione |
|---|---|
| PubChem CID | 154934626 |
| Molecular Formula | C26H36O3 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | (2S)-2-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-methyl-7-pentylchromene-5,8-dione |
| SMILES | CCCCCC1=CC(=O)C2=C(O[C@@](C)(CC/C=C(\C)CCC=C(C)C)C=C2)C1=O |
| InChI | InChI=1S/C26H36O3/c1-6-7-8-14-21-18-23(27)22-15-17-26(5,29-25(22)24(21)28)16-10-13-20(4)12-9-11-19(2)3/h11,13,15,17-18H,6-10,12,14,16H2,1-5H3/b20-13+/t26-/m0/s1 |
| InChIKey | SVPPIEMGFHBPOA-DKGRHVEHSA-N |
| XLogP | 6.72 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|