About 4-[[(2E)-2-[(3,5-dichlorophenyl)methylidene]-1-oxo-3H-inden-5-yl]oxymethyl]benzaldehyde
4-[[(2E)-2-[(3,5-dichlorophenyl)methylidene]-1-oxo-3H-inden-5-yl]oxymethyl]benzaldehyde (PubChem CID 154934644) has the molecular formula C24H16Cl2O3
and a molecular weight of 423.30 g/mol. Its IUPAC name is 4-[[(2E)-2-[(3,5-dichlorophenyl)methylidene]-1-oxo-3H-inden-5-yl]oxymethyl]benzaldehyde.
Molecular Properties
| Compound Name | 4-[[(2E)-2-[(3,5-dichlorophenyl)methylidene]-1-oxo-3H-inden-5-yl]oxymethyl]benzaldehyde |
| PubChem CID | 154934644 |
| Molecular Formula | C24H16Cl2O3 |
| Molecular Weight | 423.30 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | 4-[[(2E)-2-[(3,5-dichlorophenyl)methylidene]-1-oxo-3H-inden-5-yl]oxymethyl]benzaldehyde |
| SMILES | O=Cc1ccc(COc2ccc3c(c2)C/C(=C\c2cc(Cl)cc(Cl)c2)C3=O)cc1 |
| InChI | InChI=1S/C24H16Cl2O3/c25-20-8-17(9-21(26)12-20)7-19-10-18-11-22(5-6-23(18)24(19)28)29-14-16-3-1-15(13-27)2-4-16/h1-9,11-13H,10,14H2/b19-7+ |
| InChIKey | DAQDCRWEXRYTAQ-FBCYGCLPSA-N |
| XLogP | 6.21 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.30 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[[(2E)-2-[(3,5-dichlorophenyl)methylidene]-1-oxo-3H-inden-5-yl]oxymethyl]benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(2E)-2-[(3,5-dichlorophenyl)methylidene]-1-oxo-3H-inden-5-yl]oxymethyl]benzaldehyde?
The IUPAC name of 4-[[(2E)-2-[(3,5-dichlorophenyl)methylidene]-1-oxo-3H-inden-5-yl]oxymethyl]benzaldehyde (CID 154934644) is 4-[[(2E)-2-[(3,5-dichlorophenyl)methylidene]-1-oxo-3H-inden-5-yl]oxymethyl]benzaldehyde.
What is the SMILES notation for 4-[[(2E)-2-[(3,5-dichlorophenyl)methylidene]-1-oxo-3H-inden-5-yl]oxymethyl]benzaldehyde?
The canonical SMILES for 4-[[(2E)-2-[(3,5-dichlorophenyl)methylidene]-1-oxo-3H-inden-5-yl]oxymethyl]benzaldehyde is O=Cc1ccc(COc2ccc3c(c2)C/C(=C\c2cc(Cl)cc(Cl)c2)C3=O)cc1.
What is the InChIKey of 4-[[(2E)-2-[(3,5-dichlorophenyl)methylidene]-1-oxo-3H-inden-5-yl]oxymethyl]benzaldehyde?
The InChIKey is DAQDCRWEXRYTAQ-FBCYGCLPSA-N. The full InChI is InChI=1S/C24H16Cl2O3/c25-20-8-17(9-21(26)12-20)7-19-10-18-11-22(5-6-23(18)24(19)28)29-14-16-3-1-15(13-27)2-4-16/h1-9,11-13H,10,14H2/b19-7+.
What are the key properties of 4-[[(2E)-2-[(3,5-dichlorophenyl)methylidene]-1-oxo-3H-inden-5-yl]oxymethyl]benzaldehyde?
4-[[(2E)-2-[(3,5-dichlorophenyl)methylidene]-1-oxo-3H-inden-5-yl]oxymethyl]benzaldehyde has a molecular weight of 423.30 g/mol, XLogP of 6.21, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(2E)-2-[(3,5-dichlorophenyl)methylidene]-1-oxo-3H-inden-5-yl]oxymethyl]benzaldehyde is sourced from PubChem (CID 154934644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).