About [N'-[3-(dimethylamino)propyl]-N-ethylcarbamimidoyl] 2-iodoacetate
[N'-[3-(dimethylamino)propyl]-N-ethylcarbamimidoyl] 2-iodoacetate (PubChem CID 154935496) has the molecular formula C10H20IN3O2
and a molecular weight of 341.19 g/mol. Its IUPAC name is [N'-[3-(dimethylamino)propyl]-N-ethylcarbamimidoyl] 2-iodoacetate.
Molecular Properties
| Compound Name | [N'-[3-(dimethylamino)propyl]-N-ethylcarbamimidoyl] 2-iodoacetate |
| PubChem CID | 154935496 |
| Molecular Formula | C10H20IN3O2 |
| Molecular Weight | 341.19 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | [N'-[3-(dimethylamino)propyl]-N-ethylcarbamimidoyl] 2-iodoacetate |
| SMILES | CCN/C(=N\CCCN(C)C)OC(=O)CI |
| InChI | InChI=1S/C10H20IN3O2/c1-4-12-10(16-9(15)8-11)13-6-5-7-14(2)3/h4-8H2,1-3H3,(H,12,13) |
| InChIKey | PJAZHPADAVCEAH-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.19 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [N'-[3-(dimethylamino)propyl]-N-ethylcarbamimidoyl] 2-iodoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [N'-[3-(dimethylamino)propyl]-N-ethylcarbamimidoyl] 2-iodoacetate?
The IUPAC name of [N'-[3-(dimethylamino)propyl]-N-ethylcarbamimidoyl] 2-iodoacetate (CID 154935496) is [N'-[3-(dimethylamino)propyl]-N-ethylcarbamimidoyl] 2-iodoacetate.
What is the SMILES notation for [N'-[3-(dimethylamino)propyl]-N-ethylcarbamimidoyl] 2-iodoacetate?
The canonical SMILES for [N'-[3-(dimethylamino)propyl]-N-ethylcarbamimidoyl] 2-iodoacetate is CCN/C(=N\CCCN(C)C)OC(=O)CI.
What is the InChIKey of [N'-[3-(dimethylamino)propyl]-N-ethylcarbamimidoyl] 2-iodoacetate?
The InChIKey is PJAZHPADAVCEAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20IN3O2/c1-4-12-10(16-9(15)8-11)13-6-5-7-14(2)3/h4-8H2,1-3H3,(H,12,13).
What are the key properties of [N'-[3-(dimethylamino)propyl]-N-ethylcarbamimidoyl] 2-iodoacetate?
[N'-[3-(dimethylamino)propyl]-N-ethylcarbamimidoyl] 2-iodoacetate has a molecular weight of 341.19 g/mol, XLogP of 0.88, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [N'-[3-(dimethylamino)propyl]-N-ethylcarbamimidoyl] 2-iodoacetate is sourced from PubChem (CID 154935496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).