C38H53NO3S2 — CID 154935700
2-[4,7-bis[[4-(4-methylcyclohexyl)cyclohexyl]methoxy]-1,3-benzodithiol-2-ylidene]-3-oxopropanenitrile (PubChem CID 154935700) has the molecular formula C38H53NO3S2 and a molecular weight of 635.98 g/mol. Its IUPAC name is 2-[4,7-bis[[4-(4-methylcyclohexyl)cyclohexyl]methoxy]-1,3-benzodithiol-2-ylidene]-3-oxopropanenitrile.
| Compound Name | 2-[4,7-bis[[4-(4-methylcyclohexyl)cyclohexyl]methoxy]-1,3-benzodithiol-2-ylidene]-3-oxopropanenitrile |
|---|---|
| PubChem CID | 154935700 |
| Molecular Formula | C38H53NO3S2 |
| Molecular Weight | 635.98 g/mol |
| Exact Mass | 635.35 |
| IUPAC Name | 2-[4,7-bis[[4-(4-methylcyclohexyl)cyclohexyl]methoxy]-1,3-benzodithiol-2-ylidene]-3-oxopropanenitrile |
| SMILES | CC1CCC(C2CCC(COc3ccc(OCC4CCC(C5CCC(C)CC5)CC4)c4c3SC(=C(C#N)C=O)S4)CC2)CC1 |
| InChI | InChI=1S/C38H53NO3S2/c1-25-3-11-29(12-4-25)31-15-7-27(8-16-31)23-41-34-19-20-35(37-36(34)43-38(44-37)33(21-39)22-40)42-24-28-9-17-32(18-10-28)30-13-5-26(2)6-14-30/h19-20,22,25-32H,3-18,23-24H2,1-2H3 |
| InChIKey | NCQODUOMCFVROO-UHFFFAOYSA-N |
| XLogP | 10.84 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.98 |
| LogP ≤ 5 | 10.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|