C29H20N4O4 — CID 154936250
4-[[5-[N-(1,3-oxazol-2-yl)anilino]furan-2-yl]methylidene]-1,2-diphenylpyrazolidine-3,5-dione (PubChem CID 154936250) has the molecular formula C29H20N4O4 and a molecular weight of 488.50 g/mol. Its IUPAC name is 4-[[5-[N-(1,3-oxazol-2-yl)anilino]furan-2-yl]methylidene]-1,2-diphenylpyrazolidine-3,5-dione.
| Compound Name | 4-[[5-[N-(1,3-oxazol-2-yl)anilino]furan-2-yl]methylidene]-1,2-diphenylpyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 154936250 |
| Molecular Formula | C29H20N4O4 |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | 4-[[5-[N-(1,3-oxazol-2-yl)anilino]furan-2-yl]methylidene]-1,2-diphenylpyrazolidine-3,5-dione |
| SMILES | O=C1C(=Cc2ccc(N(c3ccccc3)c3ncco3)o2)C(=O)N(c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C29H20N4O4/c34-27-25(28(35)33(23-14-8-3-9-15-23)32(27)22-12-6-2-7-13-22)20-24-16-17-26(37-24)31(29-30-18-19-36-29)21-10-4-1-5-11-21/h1-20H |
| InChIKey | RPBOTSLQIXWYKO-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 83.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|