C25H37NO — CID 154936638
[[4-(1,4-dimethylcyclohex-2-en-1-yl)-4,6-dimethylcyclohex-2-en-1-yl]amino]-(4-methylcyclohepta-2,4,6-trien-1-yl)methanol (PubChem CID 154936638) has the molecular formula C25H37NO and a molecular weight of 367.58 g/mol. Its IUPAC name is [[4-(1,4-dimethylcyclohex-2-en-1-yl)-4,6-dimethylcyclohex-2-en-1-yl]amino]-(4-methylcyclohepta-2,4,6-trien-1-yl)methanol.
| Compound Name | [[4-(1,4-dimethylcyclohex-2-en-1-yl)-4,6-dimethylcyclohex-2-en-1-yl]amino]-(4-methylcyclohepta-2,4,6-trien-1-yl)methanol |
|---|---|
| PubChem CID | 154936638 |
| Molecular Formula | C25H37NO |
| Molecular Weight | 367.58 g/mol |
| Exact Mass | 367.29 |
| IUPAC Name | [[4-(1,4-dimethylcyclohex-2-en-1-yl)-4,6-dimethylcyclohex-2-en-1-yl]amino]-(4-methylcyclohepta-2,4,6-trien-1-yl)methanol |
| SMILES | CC1=CC=CC(C(O)NC2C=CC(C)(C3(C)C=CC(C)CC3)CC2C)C=C1 |
| InChI | InChI=1S/C25H37NO/c1-18-7-6-8-21(10-9-18)23(27)26-22-13-16-25(5,17-20(22)3)24(4)14-11-19(2)12-15-24/h6-11,13-14,16,19-23,26-27H,12,15,17H2,1-5H3 |
| InChIKey | NZBLAKMHNUQFTF-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.58 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|