C17H29FO — CID 154936640
(1R,4E,8S)-9-[2-(2-fluoro-2-methylpropoxy)-2-methylpropyl]bicyclo[6.1.0]non-4-ene (PubChem CID 154936640) has the molecular formula C17H29FO and a molecular weight of 268.42 g/mol. Its IUPAC name is (1R,4E,8S)-9-[2-(2-fluoro-2-methylpropoxy)-2-methylpropyl]bicyclo[6.1.0]non-4-ene.
| Compound Name | (1R,4E,8S)-9-[2-(2-fluoro-2-methylpropoxy)-2-methylpropyl]bicyclo[6.1.0]non-4-ene |
|---|---|
| PubChem CID | 154936640 |
| Molecular Formula | C17H29FO |
| Molecular Weight | 268.42 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | (1R,4E,8S)-9-[2-(2-fluoro-2-methylpropoxy)-2-methylpropyl]bicyclo[6.1.0]non-4-ene |
| SMILES | CC(C)(F)COC(C)(C)CC1[C@H]2CC/C=C\CC[C@@H]12 |
| InChI | InChI=1S/C17H29FO/c1-16(2,18)12-19-17(3,4)11-15-13-9-7-5-6-8-10-14(13)15/h5-6,13-15H,7-12H2,1-4H3/b6-5-/t13-,14+,15? |
| InChIKey | ILPZWUQCAXCTFL-CYHPNZPZSA-N |
| XLogP | 4.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.42 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|