C18H23N5O5 — CID 154936648
3-[2-[2-[[2-[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]acetyl]amino]ethoxy]ethoxy]propanoic acid (PubChem CID 154936648) has the molecular formula C18H23N5O5 and a molecular weight of 389.41 g/mol. Its IUPAC name is 3-[2-[2-[[2-[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]acetyl]amino]ethoxy]ethoxy]propanoic acid.
| Compound Name | 3-[2-[2-[[2-[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]acetyl]amino]ethoxy]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 154936648 |
| Molecular Formula | C18H23N5O5 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 3-[2-[2-[[2-[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]acetyl]amino]ethoxy]ethoxy]propanoic acid |
| SMILES | Cc1nnc(-c2ccc(CC(=O)NCCOCCOCCC(=O)O)cc2)nn1 |
| InChI | InChI=1S/C18H23N5O5/c1-13-20-22-18(23-21-13)15-4-2-14(3-5-15)12-16(24)19-7-9-28-11-10-27-8-6-17(25)26/h2-5H,6-12H2,1H3,(H,19,24)(H,25,26) |
| InChIKey | XMWFAVHBELNIOR-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 136.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|