About 2-[[(4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]amino]propane-2-thiol
2-[[(4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]amino]propane-2-thiol (PubChem CID 154936730) has the molecular formula C7H14N2OS
and a molecular weight of 174.27 g/mol. Its IUPAC name is 2-[[(4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]amino]propane-2-thiol.
Molecular Properties
| Compound Name | 2-[[(4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]amino]propane-2-thiol |
| PubChem CID | 154936730 |
| Molecular Formula | C7H14N2OS |
| Molecular Weight | 174.27 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 2-[[(4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]amino]propane-2-thiol |
| SMILES | C[C@H]1COC(NC(C)(C)S)=N1 |
| InChI | InChI=1S/C7H14N2OS/c1-5-4-10-6(8-5)9-7(2,3)11/h5,11H,4H2,1-3H3,(H,8,9)/t5-/m0/s1 |
| InChIKey | XDCPYWBWHGDTLW-YFKPBYRVSA-N |
| XLogP | 1.02 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.27 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]amino]propane-2-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]amino]propane-2-thiol?
The IUPAC name of 2-[[(4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]amino]propane-2-thiol (CID 154936730) is 2-[[(4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]amino]propane-2-thiol.
What is the SMILES notation for 2-[[(4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]amino]propane-2-thiol?
The canonical SMILES for 2-[[(4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]amino]propane-2-thiol is C[C@H]1COC(NC(C)(C)S)=N1.
What is the InChIKey of 2-[[(4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]amino]propane-2-thiol?
The InChIKey is XDCPYWBWHGDTLW-YFKPBYRVSA-N. The full InChI is InChI=1S/C7H14N2OS/c1-5-4-10-6(8-5)9-7(2,3)11/h5,11H,4H2,1-3H3,(H,8,9)/t5-/m0/s1.
What are the key properties of 2-[[(4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]amino]propane-2-thiol?
2-[[(4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]amino]propane-2-thiol has a molecular weight of 174.27 g/mol, XLogP of 1.02, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]amino]propane-2-thiol is sourced from PubChem (CID 154936730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).