C16H22FNO2 — CID 154937033
(2E)-3-ethoxy-2-ethyl-N-(4-fluorocyclohexa-2,4-dien-1-yl)-N-methylpenta-2,4-dienamide (PubChem CID 154937033) has the molecular formula C16H22FNO2 and a molecular weight of 279.36 g/mol. Its IUPAC name is (2E)-3-ethoxy-2-ethyl-N-(4-fluorocyclohexa-2,4-dien-1-yl)-N-methylpenta-2,4-dienamide.
| Compound Name | (2E)-3-ethoxy-2-ethyl-N-(4-fluorocyclohexa-2,4-dien-1-yl)-N-methylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 154937033 |
| Molecular Formula | C16H22FNO2 |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | (2E)-3-ethoxy-2-ethyl-N-(4-fluorocyclohexa-2,4-dien-1-yl)-N-methylpenta-2,4-dienamide |
| SMILES | C=C/C(OCC)=C(/CC)C(=O)N(C)C1C=CC(F)=CC1 |
| InChI | InChI=1S/C16H22FNO2/c1-5-14(15(6-2)20-7-3)16(19)18(4)13-10-8-12(17)9-11-13/h6,8-10,13H,2,5,7,11H2,1,3-4H3/b15-14+ |
| InChIKey | GOMOJXJCTVDOKR-CCEZHUSRSA-N |
| XLogP | 3.51 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|